2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate

C13H27NO2 — CID 129131570

IUPAC2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate
SMILESCC(C)C(OC(=O)C(C)(C)N(C)C)C(C)C
InChIInChI=1S/C13H27NO2/c1-9(2)11(10(3)4)16-12(15)13(5,6)14(7)8/h9-11H,1-8H3
InChIKeyYJMXCIZFAFDCLT-UHFFFAOYSA-N
MW229.36 g/mol
LogP2.55
Rot. Bonds5

About 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate

2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate (PubChem CID 129131570) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate.

Molecular Properties

Compound Name2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate
PubChem CID129131570
Molecular FormulaC13H27NO2
Molecular Weight229.36 g/mol
Exact Mass229.20
IUPAC Name2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate
SMILESCC(C)C(OC(=O)C(C)(C)N(C)C)C(C)C
InChIInChI=1S/C13H27NO2/c1-9(2)11(10(3)4)16-12(15)13(5,6)14(7)8/h9-11H,1-8H3
InChIKeyYJMXCIZFAFDCLT-UHFFFAOYSA-N
XLogP2.55
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.36
LogP ≤ 52.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate?
The IUPAC name of 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate (CID 129131570) is 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate.
What is the SMILES notation for 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate?
The canonical SMILES for 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate is CC(C)C(OC(=O)C(C)(C)N(C)C)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate?
The InChIKey is YJMXCIZFAFDCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-9(2)11(10(3)4)16-12(15)13(5,6)14(7)8/h9-11H,1-8H3.
What are the key properties of 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate?
2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate has a molecular weight of 229.36 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-yl 2-(dimethylamino)-2-methylpropanoate is sourced from PubChem (CID 129131570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).