C14H28O2S — CID 129131659
2,4-dimethylpentan-3-yl 2,2,3-trimethyl-3-sulfanylbutanoate (PubChem CID 129131659) has the molecular formula C14H28O2S and a molecular weight of 260.44 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl 2,2,3-trimethyl-3-sulfanylbutanoate.
| Compound Name | 2,4-dimethylpentan-3-yl 2,2,3-trimethyl-3-sulfanylbutanoate |
|---|---|
| PubChem CID | 129131659 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2,4-dimethylpentan-3-yl 2,2,3-trimethyl-3-sulfanylbutanoate |
| SMILES | CC(C)C(OC(=O)C(C)(C)C(C)(C)S)C(C)C |
| InChI | InChI=1S/C14H28O2S/c1-9(2)11(10(3)4)16-12(15)13(5,6)14(7,8)17/h9-11,17H,1-8H3 |
| InChIKey | NWYIQWJDALVDIJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|