C9H17NO3 — CID 135010538
2-oxohexan-3-yl N,N-dimethylcarbamate (PubChem CID 135010538) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-oxohexan-3-yl N,N-dimethylcarbamate.
| Compound Name | 2-oxohexan-3-yl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 135010538 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-oxohexan-3-yl N,N-dimethylcarbamate |
| SMILES | CCCC(OC(=O)N(C)C)C(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-5-6-8(7(2)11)13-9(12)10(3)4/h8H,5-6H2,1-4H3 |
| InChIKey | WMPPSKPPBFFVIC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |