About ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate
ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate (PubChem CID 143554574) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate.
Molecular Properties
| Compound Name | ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate |
| PubChem CID | 143554574 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate |
| SMILES | C=C(C)COC(CCC)C(C)=O.CC.O |
| InChI | InChI=1S/C10H18O2.C2H6.H2O/c1-5-6-10(9(4)11)12-7-8(2)3;1-2;/h10H,2,5-7H2,1,3-4H3;1-2H3;1H2 |
| InChIKey | JLHWJHALJVCPKX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate?
The IUPAC name of ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate (CID 143554574) is ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate.
What is the SMILES notation for ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate?
The canonical SMILES for ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate is C=C(C)COC(CCC)C(C)=O.CC.O.
What is the InChIKey of ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate?
The InChIKey is JLHWJHALJVCPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C2H6.H2O/c1-5-6-10(9(4)11)12-7-8(2)3;1-2;/h10H,2,5-7H2,1,3-4H3;1-2H3;1H2.
What are the key properties of ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate?
ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate has a molecular weight of 218.34 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(2-methylprop-2-enoxy)hexan-2-one;hydrate is sourced from PubChem (CID 143554574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).