C21H21N2O3+ — CID 4101476
(4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate (PubChem CID 4101476) has the molecular formula C21H21N2O3+ and a molecular weight of 349.41 g/mol. Its IUPAC name is (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate.
| Compound Name | (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 4101476 |
| Molecular Formula | C21H21N2O3+ |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4-methoxy-2,6-dimethylpyridin-1-ium-1-yl) N,N-diphenylcarbamate |
| SMILES | COc1cc(C)[n+](OC(=O)N(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H21N2O3/c1-16-14-20(25-3)15-17(2)23(16)26-21(24)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-15H,1-3H3/q+1 |
| InChIKey | JITVRNYXIFBVJT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|