C15H10Cl3NO3 — CID 18546385
2-(N-(2,6-dichloro-4-methoxyphenyl)anilino)-2-oxoacetyl chloride (PubChem CID 18546385) has the molecular formula C15H10Cl3NO3 and a molecular weight of 358.61 g/mol. Its IUPAC name is 2-(N-(2,6-dichloro-4-methoxyphenyl)anilino)-2-oxoacetyl chloride.
| Compound Name | 2-(N-(2,6-dichloro-4-methoxyphenyl)anilino)-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 18546385 |
| Molecular Formula | C15H10Cl3NO3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-(N-(2,6-dichloro-4-methoxyphenyl)anilino)-2-oxoacetyl chloride |
| SMILES | COc1cc(Cl)c(N(C(=O)C(=O)Cl)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3NO3/c1-22-10-7-11(16)13(12(17)8-10)19(15(21)14(18)20)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | VAHFOBFCCULFDB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|