C20H15Cl2NO2 — CID 154952087
N-(2,6-dichlorophenyl)-N-(4-methoxyphenyl)benzamide (PubChem CID 154952087) has the molecular formula C20H15Cl2NO2 and a molecular weight of 372.25 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-N-(4-methoxyphenyl)benzamide.
| Compound Name | N-(2,6-dichlorophenyl)-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 154952087 |
| Molecular Formula | C20H15Cl2NO2 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-(2,6-dichlorophenyl)-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccccc2)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2NO2/c1-25-16-12-10-15(11-13-16)23(19-17(21)8-5-9-18(19)22)20(24)14-6-3-2-4-7-14/h2-13H,1H3 |
| InChIKey | UOQNCGMCEVAPRX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |