C19H13Cl2NO — CID 14251439
N-(2,6-dichlorophenyl)-N-phenylbenzamide (PubChem CID 14251439) has the molecular formula C19H13Cl2NO and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-N-phenylbenzamide.
| Compound Name | N-(2,6-dichlorophenyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 14251439 |
| Molecular Formula | C19H13Cl2NO |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-N-phenylbenzamide |
| SMILES | O=C(c1ccccc1)N(c1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H13Cl2NO/c20-16-12-7-13-17(21)18(16)22(15-10-5-2-6-11-15)19(23)14-8-3-1-4-9-14/h1-13H |
| InChIKey | BLWQXJQASBCCBC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |