C15H11Cl2NO5S — CID 53240791
[benzoyl-(2,6-dichlorophenyl)sulfonylamino] acetate (PubChem CID 53240791) has the molecular formula C15H11Cl2NO5S and a molecular weight of 388.23 g/mol. Its IUPAC name is [benzoyl-(2,6-dichlorophenyl)sulfonylamino] acetate.
| Compound Name | [benzoyl-(2,6-dichlorophenyl)sulfonylamino] acetate |
|---|---|
| PubChem CID | 53240791 |
| Molecular Formula | C15H11Cl2NO5S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | [benzoyl-(2,6-dichlorophenyl)sulfonylamino] acetate |
| SMILES | CC(=O)ON(C(=O)c1ccccc1)S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H11Cl2NO5S/c1-10(19)23-18(15(20)11-6-3-2-4-7-11)24(21,22)14-12(16)8-5-9-13(14)17/h2-9H,1H3 |
| InChIKey | OYENWGYMUNZJGF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|