C11H12Cl2NO2- — CID 20515116
N-tert-butyl-2,6-dichloro-N-oxidobenzamide (PubChem CID 20515116) has the molecular formula C11H12Cl2NO2- and a molecular weight of 261.13 g/mol. Its IUPAC name is N-tert-butyl-2,6-dichloro-N-oxidobenzamide.
| Compound Name | N-tert-butyl-2,6-dichloro-N-oxidobenzamide |
|---|---|
| PubChem CID | 20515116 |
| Molecular Formula | C11H12Cl2NO2- |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | N-tert-butyl-2,6-dichloro-N-oxidobenzamide |
| SMILES | CC(C)(C)N([O-])C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H12Cl2NO2/c1-11(2,3)14(16)10(15)9-7(12)5-4-6-8(9)13/h4-6H,1-3H3/q-1 |
| InChIKey | ILSBPKOBYHONQK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|