C11H11Cl2NO3 — CID 43422763
methyl 2-[(2,6-dichlorobenzoyl)-methylamino]acetate (PubChem CID 43422763) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)-methylamino]acetate.
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)-methylamino]acetate |
|---|---|
| PubChem CID | 43422763 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3/c1-14(6-9(15)17-2)11(16)10-7(12)4-3-5-8(10)13/h3-5H,6H2,1-2H3 |
| InChIKey | RPFBKXOJQOPUGO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |