methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate

C11H11BrClNO3 — CID 103994339

IUPACmethyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)c1cccc(Br)c1Cl
InChIInChI=1S/C11H11BrClNO3/c1-14(6-9(15)17-2)11(16)7-4-3-5-8(12)10(7)13/h3-5H,6H2,1-2H3
InChIKeyFCAZTTNKLVSDHQ-UHFFFAOYSA-N
MW320.57 g/mol
LogP2.35
Rot. Bonds3

About methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate

methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate (PubChem CID 103994339) has the molecular formula C11H11BrClNO3 and a molecular weight of 320.57 g/mol. Its IUPAC name is methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate
PubChem CID103994339
Molecular FormulaC11H11BrClNO3
Molecular Weight320.57 g/mol
Exact Mass318.96
IUPAC Namemethyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)c1cccc(Br)c1Cl
InChIInChI=1S/C11H11BrClNO3/c1-14(6-9(15)17-2)11(16)7-4-3-5-8(12)10(7)13/h3-5H,6H2,1-2H3
InChIKeyFCAZTTNKLVSDHQ-UHFFFAOYSA-N
XLogP2.35
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.57
LogP ≤ 52.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate?
The IUPAC name of methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate (CID 103994339) is methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate.
What is the SMILES notation for methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate?
The canonical SMILES for methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate is COC(=O)CN(C)C(=O)c1cccc(Br)c1Cl.
What is the InChIKey of methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate?
The InChIKey is FCAZTTNKLVSDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrClNO3/c1-14(6-9(15)17-2)11(16)7-4-3-5-8(12)10(7)13/h3-5H,6H2,1-2H3.
What are the key properties of methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate?
methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate has a molecular weight of 320.57 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-bromo-2-chlorobenzoyl)-methylamino]acetate is sourced from PubChem (CID 103994339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).