C13H16BrClN2O2 — CID 113361108
3-bromo-2-chloro-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 113361108) has the molecular formula C13H16BrClN2O2 and a molecular weight of 347.64 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-bromo-2-chloro-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 113361108 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-bromo-2-chloro-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C13H16BrClN2O2/c1-8(2)16-11(18)7-17(3)13(19)9-5-4-6-10(14)12(9)15/h4-6,8H,7H2,1-3H3,(H,16,18) |
| InChIKey | OCWZNPRDEFNYCF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |