C14H10Cl3NO — CID 169436235
2-chloro-N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-(2,6-dichlorophenyl)acetamide (PubChem CID 169436235) has the molecular formula C14H10Cl3NO and a molecular weight of 320.55 g/mol. Its IUPAC name is 2-chloro-N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-chloro-N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 169436235 |
| Molecular Formula | C14H10Cl3NO |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-chloro-N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-N-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(CCl)N(c1c(Cl)cccc1Cl)[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C14H10Cl3NO/c15-9-13(19)18(10-5-2-1-3-6-10)14-11(16)7-4-8-12(14)17/h1-8H,9H2/i1+1,2+1,3+1,5+1,6+1,10+1 |
| InChIKey | BPEUHDIEZQWRGC-CSPPZNRPSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|