C43H40N2O4 — CID 157213246
4-butoxy-N,N-diphenylbenzamide;4-methoxy-N,N-diphenylbenzamide (PubChem CID 157213246) has the molecular formula C43H40N2O4 and a molecular weight of 648.80 g/mol. Its IUPAC name is 4-butoxy-N,N-diphenylbenzamide;4-methoxy-N,N-diphenylbenzamide.
| Compound Name | 4-butoxy-N,N-diphenylbenzamide;4-methoxy-N,N-diphenylbenzamide |
|---|---|
| PubChem CID | 157213246 |
| Molecular Formula | C43H40N2O4 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | 4-butoxy-N,N-diphenylbenzamide;4-methoxy-N,N-diphenylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(c2ccccc2)c2ccccc2)cc1.COc1ccc(C(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2.C20H17NO2/c1-2-3-18-26-22-16-14-19(15-17-22)23(25)24(20-10-6-4-7-11-20)21-12-8-5-9-13-21;1-23-19-14-12-16(13-15-19)20(22)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h4-17H,2-3,18H2,1H3;2-15H,1H3 |
| InChIKey | ASCYZRXATJIIOK-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|