C41H38N2O4 — CID 18996741
4-methoxy-N-[4-[3-[4-(N-(4-methoxyphenyl)anilino)phenoxy]propoxy]phenyl]-N-phenylaniline (PubChem CID 18996741) has the molecular formula C41H38N2O4 and a molecular weight of 622.76 g/mol. Its IUPAC name is 4-methoxy-N-[4-[3-[4-(N-(4-methoxyphenyl)anilino)phenoxy]propoxy]phenyl]-N-phenylaniline.
| Compound Name | 4-methoxy-N-[4-[3-[4-(N-(4-methoxyphenyl)anilino)phenoxy]propoxy]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 18996741 |
| Molecular Formula | C41H38N2O4 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 4-methoxy-N-[4-[3-[4-(N-(4-methoxyphenyl)anilino)phenoxy]propoxy]phenyl]-N-phenylaniline |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(OCCCOc3ccc(N(c4ccccc4)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H38N2O4/c1-44-38-22-14-34(15-23-38)42(32-10-5-3-6-11-32)36-18-26-40(27-19-36)46-30-9-31-47-41-28-20-37(21-29-41)43(33-12-7-4-8-13-33)35-16-24-39(45-2)25-17-35/h3-8,10-29H,9,30-31H2,1-2H3 |
| InChIKey | PLOKQDTXEKRQQZ-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|