About potassium 2-fluorobutanoate
potassium 2-fluorobutanoate (PubChem CID 168947698) has the molecular formula C4H6FKO2
and a molecular weight of 144.19 g/mol. Its IUPAC name is potassium 2-fluorobutanoate.
Molecular Properties
| Compound Name | potassium 2-fluorobutanoate |
| PubChem CID | 168947698 |
| Molecular Formula | C4H6FKO2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | potassium 2-fluorobutanoate |
| SMILES | CCC(F)C(=O)[O-].[K+] |
| InChI | InChI=1S/C4H7FO2.K/c1-2-3(5)4(6)7;/h3H,2H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | ZAWROGVNVJQOOZ-UHFFFAOYSA-M |
| XLogP | -3.51 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 2-fluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-fluorobutanoate?
The IUPAC name of potassium 2-fluorobutanoate (CID 168947698) is potassium 2-fluorobutanoate.
What is the SMILES notation for potassium 2-fluorobutanoate?
The canonical SMILES for potassium 2-fluorobutanoate is CCC(F)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-fluorobutanoate?
The InChIKey is ZAWROGVNVJQOOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7FO2.K/c1-2-3(5)4(6)7;/h3H,2H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of potassium 2-fluorobutanoate?
potassium 2-fluorobutanoate has a molecular weight of 144.19 g/mol, XLogP of -3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-fluorobutanoate is sourced from PubChem (CID 168947698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).