C16H15ClF8 — CID 100930806
[(Z)-8-chloro-5,5,6,6,7,7,8,8-octafluoro-2,2-dimethyloct-3-en-3-yl]benzene (PubChem CID 100930806) has the molecular formula C16H15ClF8 and a molecular weight of 394.73 g/mol. Its IUPAC name is [(Z)-8-chloro-5,5,6,6,7,7,8,8-octafluoro-2,2-dimethyloct-3-en-3-yl]benzene.
| Compound Name | [(Z)-8-chloro-5,5,6,6,7,7,8,8-octafluoro-2,2-dimethyloct-3-en-3-yl]benzene |
|---|---|
| PubChem CID | 100930806 |
| Molecular Formula | C16H15ClF8 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [(Z)-8-chloro-5,5,6,6,7,7,8,8-octafluoro-2,2-dimethyloct-3-en-3-yl]benzene |
| SMILES | CC(C)(C)/C(=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15ClF8/c1-12(2,3)11(10-7-5-4-6-8-10)9-13(18,19)14(20,21)15(22,23)16(17,24)25/h4-9H,1-3H3/b11-9+ |
| InChIKey | LOWMQLHMQWHSBK-PKNBQFBNSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|