About (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine
(NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine (PubChem CID 59364072) has the molecular formula C17H14F3NO
and a molecular weight of 305.30 g/mol. Its IUPAC name is (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine |
| PubChem CID | 59364072 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine |
| SMILES | Cc1ccc(C(/C=C(/c2ccccc2)C(F)(F)F)=N\O)cc1 |
| InChI | InChI=1S/C17H14F3NO/c1-12-7-9-14(10-8-12)16(21-22)11-15(17(18,19)20)13-5-3-2-4-6-13/h2-11,22H,1H3/b15-11-,21-16- |
| InChIKey | OUDMETFPTYOODX-PCFUVJJASA-N |
| XLogP | 4.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine (CID 59364072) is (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine is Cc1ccc(C(/C=C(/c2ccccc2)C(F)(F)F)=N\O)cc1.
What is the InChIKey of (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine?
The InChIKey is OUDMETFPTYOODX-PCFUVJJASA-N. The full InChI is InChI=1S/C17H14F3NO/c1-12-7-9-14(10-8-12)16(21-22)11-15(17(18,19)20)13-5-3-2-4-6-13/h2-11,22H,1H3/b15-11-,21-16-.
What are the key properties of (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine?
(NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine has a molecular weight of 305.30 g/mol, XLogP of 4.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(Z)-4,4,4-trifluoro-1-(4-methylphenyl)-3-phenylbut-2-enylidene]hydroxylamine is sourced from PubChem (CID 59364072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).