C15H12F2 — CID 101461718
1-(2,2-difluoro-1-phenylethenyl)-4-methylbenzene (PubChem CID 101461718) has the molecular formula C15H12F2 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(2,2-difluoro-1-phenylethenyl)-4-methylbenzene.
| Compound Name | 1-(2,2-difluoro-1-phenylethenyl)-4-methylbenzene |
|---|---|
| PubChem CID | 101461718 |
| Molecular Formula | C15H12F2 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(2,2-difluoro-1-phenylethenyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(=C(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12F2/c1-11-7-9-13(10-8-11)14(15(16)17)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | FMDRRGCXMSFFSY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |