C17H13F2N — CID 172643302
3-[2,2-difluoro-1-(4-methylphenyl)ethenyl]-1H-indole (PubChem CID 172643302) has the molecular formula C17H13F2N and a molecular weight of 269.29 g/mol. Its IUPAC name is 3-[2,2-difluoro-1-(4-methylphenyl)ethenyl]-1H-indole.
| Compound Name | 3-[2,2-difluoro-1-(4-methylphenyl)ethenyl]-1H-indole |
|---|---|
| PubChem CID | 172643302 |
| Molecular Formula | C17H13F2N |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-[2,2-difluoro-1-(4-methylphenyl)ethenyl]-1H-indole |
| SMILES | Cc1ccc(C(=C(F)F)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C17H13F2N/c1-11-6-8-12(9-7-11)16(17(18)19)14-10-20-15-5-3-2-4-13(14)15/h2-10,20H,1H3 |
| InChIKey | WUSNKEPBOJCAAZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |