C23H17F3O — CID 71363336
1-(4-methylphenyl)-3,3-diphenyl-2-(trifluoromethyl)prop-2-en-1-one (PubChem CID 71363336) has the molecular formula C23H17F3O and a molecular weight of 366.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3,3-diphenyl-2-(trifluoromethyl)prop-2-en-1-one.
| Compound Name | 1-(4-methylphenyl)-3,3-diphenyl-2-(trifluoromethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71363336 |
| Molecular Formula | C23H17F3O |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(4-methylphenyl)-3,3-diphenyl-2-(trifluoromethyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C(=C(c2ccccc2)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3O/c1-16-12-14-19(15-13-16)22(27)21(23(24,25)26)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | ZTSBXHFWBOPQME-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|