C33H29NO2 — CID 10412497
[(E)-[2-(2,2-diphenylethenyl)-2-methyl-4,4-diphenylbut-3-enylidene]amino] acetate (PubChem CID 10412497) has the molecular formula C33H29NO2 and a molecular weight of 471.60 g/mol. Its IUPAC name is [(E)-[2-(2,2-diphenylethenyl)-2-methyl-4,4-diphenylbut-3-enylidene]amino] acetate.
| Compound Name | [(E)-[2-(2,2-diphenylethenyl)-2-methyl-4,4-diphenylbut-3-enylidene]amino] acetate |
|---|---|
| PubChem CID | 10412497 |
| Molecular Formula | C33H29NO2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(E)-[2-(2,2-diphenylethenyl)-2-methyl-4,4-diphenylbut-3-enylidene]amino] acetate |
| SMILES | CC(=O)O/N=C/C(C)(C=C(c1ccccc1)c1ccccc1)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H29NO2/c1-26(35)36-34-25-33(2,23-31(27-15-7-3-8-16-27)28-17-9-4-10-18-28)24-32(29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-25H,1-2H3/b34-25+ |
| InChIKey | WKGWKPSMWJEVMB-YQCHCMBFSA-N |
| XLogP | 7.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|