C17H23NO2 — CID 135073334
[(E)-(2,2,5-trimethyl-1-phenylhex-4-enylidene)amino] acetate (PubChem CID 135073334) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(E)-(2,2,5-trimethyl-1-phenylhex-4-enylidene)amino] acetate.
| Compound Name | [(E)-(2,2,5-trimethyl-1-phenylhex-4-enylidene)amino] acetate |
|---|---|
| PubChem CID | 135073334 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(E)-(2,2,5-trimethyl-1-phenylhex-4-enylidene)amino] acetate |
| SMILES | CC(=O)O/N=C(/c1ccccc1)C(C)(C)CC=C(C)C |
| InChI | InChI=1S/C17H23NO2/c1-13(2)11-12-17(4,5)16(18-20-14(3)19)15-9-7-6-8-10-15/h6-11H,12H2,1-5H3/b18-16- |
| InChIKey | DKLQTDCJFVWYMY-VLGSPTGOSA-N |
| XLogP | 4.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|