C19H31NO3Si — CID 154620555
2-[(E)-[3-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-1-phenylpropylidene]amino]oxyacetic acid (PubChem CID 154620555) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is 2-[(E)-[3-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-1-phenylpropylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[3-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-1-phenylpropylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 154620555 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 2-[(E)-[3-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-1-phenylpropylidene]amino]oxyacetic acid |
| SMILES | CC(C)(C[Si](C)(C)C(C)(C)C)/C(=N/OCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H31NO3Si/c1-18(2,3)24(6,7)14-19(4,5)17(20-23-13-16(21)22)15-11-9-8-10-12-15/h8-12H,13-14H2,1-7H3,(H,21,22)/b20-17+ |
| InChIKey | HLDQJVAPOLHIOI-LVZFUZTISA-N |
| XLogP | 5.03 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|