C15H20INO3 — CID 172930752
methyl 2-[(E)-[3-iodo-2,2-dimethyl-1-(4-methylphenyl)propylidene]amino]oxyacetate (PubChem CID 172930752) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is methyl 2-[(E)-[3-iodo-2,2-dimethyl-1-(4-methylphenyl)propylidene]amino]oxyacetate.
| Compound Name | methyl 2-[(E)-[3-iodo-2,2-dimethyl-1-(4-methylphenyl)propylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 172930752 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 2-[(E)-[3-iodo-2,2-dimethyl-1-(4-methylphenyl)propylidene]amino]oxyacetate |
| SMILES | COC(=O)CO/N=C(\c1ccc(C)cc1)C(C)(C)CI |
| InChI | InChI=1S/C15H20INO3/c1-11-5-7-12(8-6-11)14(15(2,3)10-16)17-20-9-13(18)19-4/h5-8H,9-10H2,1-4H3/b17-14+ |
| InChIKey | WCEHZSWGFCOZQC-SAPNQHFASA-N |
| XLogP | 3.35 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|