C9H16N2O3 — CID 129116589
[(E)-(2-amino-2,4,4-trimethyl-3-oxopentylidene)amino] formate (PubChem CID 129116589) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is [(E)-(2-amino-2,4,4-trimethyl-3-oxopentylidene)amino] formate.
| Compound Name | [(E)-(2-amino-2,4,4-trimethyl-3-oxopentylidene)amino] formate |
|---|---|
| PubChem CID | 129116589 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(E)-(2-amino-2,4,4-trimethyl-3-oxopentylidene)amino] formate |
| SMILES | CC(C)(C)C(=O)C(C)(N)/C=N/OC=O |
| InChI | InChI=1S/C9H16N2O3/c1-8(2,3)7(13)9(4,10)5-11-14-6-12/h5-6H,10H2,1-4H3/b11-5+ |
| InChIKey | UOSMHYBFRIZGKB-VZUCSPMQSA-N |
| XLogP | 0.48 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|