About ethene;[(E)-2-oxopropylideneamino] formate
ethene;[(E)-2-oxopropylideneamino] formate (PubChem CID 144999498) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is ethene;[(E)-2-oxopropylideneamino] formate.
Molecular Properties
| Compound Name | ethene;[(E)-2-oxopropylideneamino] formate |
| PubChem CID | 144999498 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | ethene;[(E)-2-oxopropylideneamino] formate |
| SMILES | C=C.CC(=O)/C=N/OC=O |
| InChI | InChI=1S/C4H5NO3.C2H4/c1-4(7)2-5-8-3-6;1-2/h2-3H,1H3;1-2H2/b5-2+; |
| InChIKey | PFRGBTVEMHQHOD-DPZBITMOSA-N |
| XLogP | 0.54 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethene;[(E)-2-oxopropylideneamino] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;[(E)-2-oxopropylideneamino] formate?
The IUPAC name of ethene;[(E)-2-oxopropylideneamino] formate (CID 144999498) is ethene;[(E)-2-oxopropylideneamino] formate.
What is the SMILES notation for ethene;[(E)-2-oxopropylideneamino] formate?
The canonical SMILES for ethene;[(E)-2-oxopropylideneamino] formate is C=C.CC(=O)/C=N/OC=O.
What is the InChIKey of ethene;[(E)-2-oxopropylideneamino] formate?
The InChIKey is PFRGBTVEMHQHOD-DPZBITMOSA-N. The full InChI is InChI=1S/C4H5NO3.C2H4/c1-4(7)2-5-8-3-6;1-2/h2-3H,1H3;1-2H2/b5-2+;.
What are the key properties of ethene;[(E)-2-oxopropylideneamino] formate?
ethene;[(E)-2-oxopropylideneamino] formate has a molecular weight of 143.14 g/mol, XLogP of 0.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;[(E)-2-oxopropylideneamino] formate is sourced from PubChem (CID 144999498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).