About 4-oxodec-7-enal
4-oxodec-7-enal (PubChem CID 3016242) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-oxodec-7-enal.
Molecular Properties
| Compound Name | 4-oxodec-7-enal |
| PubChem CID | 3016242 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4-oxodec-7-enal |
| SMILES | CCC=CCCC(=O)CCC=O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-7-10(12)8-6-9-11/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | PYCXUYULQFTHOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-oxodec-7-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxodec-7-enal?
The IUPAC name of 4-oxodec-7-enal (CID 3016242) is 4-oxodec-7-enal.
What is the SMILES notation for 4-oxodec-7-enal?
The canonical SMILES for 4-oxodec-7-enal is CCC=CCCC(=O)CCC=O.
What is the InChIKey of 4-oxodec-7-enal?
The InChIKey is PYCXUYULQFTHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-3-4-5-7-10(12)8-6-9-11/h3-4,9H,2,5-8H2,1H3.
What are the key properties of 4-oxodec-7-enal?
4-oxodec-7-enal has a molecular weight of 168.24 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxodec-7-enal is sourced from PubChem (CID 3016242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).