About 4-oxohexanal;zirconium
4-oxohexanal;zirconium (PubChem CID 175550400) has the molecular formula C6H10O2Zr
and a molecular weight of 205.37 g/mol. Its IUPAC name is 4-oxohexanal;zirconium.
Molecular Properties
| Compound Name | 4-oxohexanal;zirconium |
| PubChem CID | 175550400 |
| Molecular Formula | C6H10O2Zr |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 4-oxohexanal;zirconium |
| SMILES | CCC(=O)CCC=O.[Zr] |
| InChI | InChI=1S/C6H10O2.Zr/c1-2-6(8)4-3-5-7;/h5H,2-4H2,1H3; |
| InChIKey | BXUXKNDGGXXNJT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohexanal;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohexanal;zirconium?
The IUPAC name of 4-oxohexanal;zirconium (CID 175550400) is 4-oxohexanal;zirconium.
What is the SMILES notation for 4-oxohexanal;zirconium?
The canonical SMILES for 4-oxohexanal;zirconium is CCC(=O)CCC=O.[Zr].
What is the InChIKey of 4-oxohexanal;zirconium?
The InChIKey is BXUXKNDGGXXNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.Zr/c1-2-6(8)4-3-5-7;/h5H,2-4H2,1H3;.
What are the key properties of 4-oxohexanal;zirconium?
4-oxohexanal;zirconium has a molecular weight of 205.37 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohexanal;zirconium is sourced from PubChem (CID 175550400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).