C12H18O5 — CID 87281698
12-hydroxy-4,7,10-trioxododecanal (PubChem CID 87281698) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 12-hydroxy-4,7,10-trioxododecanal.
| Compound Name | 12-hydroxy-4,7,10-trioxododecanal |
|---|---|
| PubChem CID | 87281698 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 12-hydroxy-4,7,10-trioxododecanal |
| SMILES | O=CCCC(=O)CCC(=O)CCC(=O)CCO |
| InChI | InChI=1S/C12H18O5/c13-8-1-2-10(15)3-4-11(16)5-6-12(17)7-9-14/h8,14H,1-7,9H2 |
| InChIKey | RZXDUBCZLVWUKH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|