8-hydroxy-6-oxooctanoic acid

C8H14O4 — CID 22280337

IUPAC8-hydroxy-6-oxooctanoic acid
SMILESO=C(O)CCCCC(=O)CCO
InChIInChI=1S/C8H14O4/c9-6-5-7(10)3-1-2-4-8(11)12/h9H,1-6H2,(H,11,12)
InChIKeyRVYNWKZJNVDBDG-UHFFFAOYSA-N
MW174.20 g/mol
LogP0.58
Rot. Bonds7

About 8-hydroxy-6-oxooctanoic acid

8-hydroxy-6-oxooctanoic acid (PubChem CID 22280337) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 8-hydroxy-6-oxooctanoic acid.

Molecular Properties

Compound Name8-hydroxy-6-oxooctanoic acid
PubChem CID22280337
Molecular FormulaC8H14O4
Molecular Weight174.20 g/mol
Exact Mass174.09
IUPAC Name8-hydroxy-6-oxooctanoic acid
SMILESO=C(O)CCCCC(=O)CCO
InChIInChI=1S/C8H14O4/c9-6-5-7(10)3-1-2-4-8(11)12/h9H,1-6H2,(H,11,12)
InChIKeyRVYNWKZJNVDBDG-UHFFFAOYSA-N
XLogP0.58
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 8-hydroxy-6-oxooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-hydroxy-6-oxooctanoic acid?
The IUPAC name of 8-hydroxy-6-oxooctanoic acid (CID 22280337) is 8-hydroxy-6-oxooctanoic acid.
What is the SMILES notation for 8-hydroxy-6-oxooctanoic acid?
The canonical SMILES for 8-hydroxy-6-oxooctanoic acid is O=C(O)CCCCC(=O)CCO.
What is the InChIKey of 8-hydroxy-6-oxooctanoic acid?
The InChIKey is RVYNWKZJNVDBDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c9-6-5-7(10)3-1-2-4-8(11)12/h9H,1-6H2,(H,11,12).
What are the key properties of 8-hydroxy-6-oxooctanoic acid?
8-hydroxy-6-oxooctanoic acid has a molecular weight of 174.20 g/mol, XLogP of 0.58, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-6-oxooctanoic acid is sourced from PubChem (CID 22280337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).