About 7-bromo-6-oxoheptanoic acid
7-bromo-6-oxoheptanoic acid (PubChem CID 57379211) has the molecular formula C7H11BrO3
and a molecular weight of 223.07 g/mol. Its IUPAC name is 7-bromo-6-oxoheptanoic acid.
Molecular Properties
| Compound Name | 7-bromo-6-oxoheptanoic acid |
| PubChem CID | 57379211 |
| Molecular Formula | C7H11BrO3 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 7-bromo-6-oxoheptanoic acid |
| SMILES | O=C(O)CCCCC(=O)CBr |
| InChI | InChI=1S/C7H11BrO3/c8-5-6(9)3-1-2-4-7(10)11/h1-5H2,(H,10,11) |
| InChIKey | QQRCVAXGZKZAHZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-6-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-6-oxoheptanoic acid?
The IUPAC name of 7-bromo-6-oxoheptanoic acid (CID 57379211) is 7-bromo-6-oxoheptanoic acid.
What is the SMILES notation for 7-bromo-6-oxoheptanoic acid?
The canonical SMILES for 7-bromo-6-oxoheptanoic acid is O=C(O)CCCCC(=O)CBr.
What is the InChIKey of 7-bromo-6-oxoheptanoic acid?
The InChIKey is QQRCVAXGZKZAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO3/c8-5-6(9)3-1-2-4-7(10)11/h1-5H2,(H,10,11).
What are the key properties of 7-bromo-6-oxoheptanoic acid?
7-bromo-6-oxoheptanoic acid has a molecular weight of 223.07 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-oxoheptanoic acid is sourced from PubChem (CID 57379211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).