C13H20O6 — CID 59648927
6,8-dioxotridecanedioic acid (PubChem CID 59648927) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 6,8-dioxotridecanedioic acid.
| Compound Name | 6,8-dioxotridecanedioic acid |
|---|---|
| PubChem CID | 59648927 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6,8-dioxotridecanedioic acid |
| SMILES | O=C(O)CCCCC(=O)CC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C13H20O6/c14-10(5-1-3-7-12(16)17)9-11(15)6-2-4-8-13(18)19/h1-9H2,(H,16,17)(H,18,19) |
| InChIKey | FBWCUISBRMRCRC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|