About 6-amino-4-oxohexanal
6-amino-4-oxohexanal (PubChem CID 23192473) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 6-amino-4-oxohexanal.
Molecular Properties
| Compound Name | 6-amino-4-oxohexanal |
| PubChem CID | 23192473 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 6-amino-4-oxohexanal |
| SMILES | NCCC(=O)CCC=O |
| InChI | InChI=1S/C6H11NO2/c7-4-3-6(9)2-1-5-8/h5H,1-4,7H2 |
| InChIKey | UIZQFJFPFWWJSJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-oxohexanal?
The IUPAC name of 6-amino-4-oxohexanal (CID 23192473) is 6-amino-4-oxohexanal.
What is the SMILES notation for 6-amino-4-oxohexanal?
The canonical SMILES for 6-amino-4-oxohexanal is NCCC(=O)CCC=O.
What is the InChIKey of 6-amino-4-oxohexanal?
The InChIKey is UIZQFJFPFWWJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c7-4-3-6(9)2-1-5-8/h5H,1-4,7H2.
What are the key properties of 6-amino-4-oxohexanal?
6-amino-4-oxohexanal has a molecular weight of 129.16 g/mol, XLogP of -0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-oxohexanal is sourced from PubChem (CID 23192473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).