About 1-aminohexan-3-one;carbon dioxide
1-aminohexan-3-one;carbon dioxide (PubChem CID 158553440) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-aminohexan-3-one;carbon dioxide.
Molecular Properties
| Compound Name | 1-aminohexan-3-one;carbon dioxide |
| PubChem CID | 158553440 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-aminohexan-3-one;carbon dioxide |
| SMILES | CCCC(=O)CCN.O=C=O |
| InChI | InChI=1S/C6H13NO.CO2/c1-2-3-6(8)4-5-7;2-1-3/h2-5,7H2,1H3; |
| InChIKey | HPZNKMLYNVSXPQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-aminohexan-3-one;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminohexan-3-one;carbon dioxide?
The IUPAC name of 1-aminohexan-3-one;carbon dioxide (CID 158553440) is 1-aminohexan-3-one;carbon dioxide.
What is the SMILES notation for 1-aminohexan-3-one;carbon dioxide?
The canonical SMILES for 1-aminohexan-3-one;carbon dioxide is CCCC(=O)CCN.O=C=O.
What is the InChIKey of 1-aminohexan-3-one;carbon dioxide?
The InChIKey is HPZNKMLYNVSXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.CO2/c1-2-3-6(8)4-5-7;2-1-3/h2-5,7H2,1H3;.
What are the key properties of 1-aminohexan-3-one;carbon dioxide?
1-aminohexan-3-one;carbon dioxide has a molecular weight of 159.18 g/mol, XLogP of 0.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminohexan-3-one;carbon dioxide is sourced from PubChem (CID 158553440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).