C13H20O2 — CID 10443045
(3E,8E)-3,9-dimethylundeca-3,8-diene-2,10-dione (PubChem CID 10443045) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (3E,8E)-3,9-dimethylundeca-3,8-diene-2,10-dione.
| Compound Name | (3E,8E)-3,9-dimethylundeca-3,8-diene-2,10-dione |
|---|---|
| PubChem CID | 10443045 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (3E,8E)-3,9-dimethylundeca-3,8-diene-2,10-dione |
| SMILES | CC(=O)/C(C)=C/CCC/C=C(\C)C(C)=O |
| InChI | InChI=1S/C13H20O2/c1-10(12(3)14)8-6-5-7-9-11(2)13(4)15/h8-9H,5-7H2,1-4H3/b10-8+,11-9+ |
| InChIKey | NQXMUKWFSVBWPH-GFULKKFKSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|