C14H20OS — CID 89076094
(5E,7E)-7-methylsulfanyl-5-[(Z)-prop-1-enyl]deca-5,7,9-trien-3-one (PubChem CID 89076094) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is (5E,7E)-7-methylsulfanyl-5-[(Z)-prop-1-enyl]deca-5,7,9-trien-3-one.
| Compound Name | (5E,7E)-7-methylsulfanyl-5-[(Z)-prop-1-enyl]deca-5,7,9-trien-3-one |
|---|---|
| PubChem CID | 89076094 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (5E,7E)-7-methylsulfanyl-5-[(Z)-prop-1-enyl]deca-5,7,9-trien-3-one |
| SMILES | C=C/C=C(\C=C(\C=C/C)CC(=O)CC)SC |
| InChI | InChI=1S/C14H20OS/c1-5-8-12(10-13(15)7-3)11-14(16-4)9-6-2/h5-6,8-9,11H,2,7,10H2,1,3-4H3/b8-5-,12-11-,14-9+ |
| InChIKey | FGUDNRCBHPJRLB-JHMUAXLMSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|