C16H24 — CID 123252708
7-ethyl-4-methyl-5-prop-2-enylidenedeca-1,6,8-triene (PubChem CID 123252708) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 7-ethyl-4-methyl-5-prop-2-enylidenedeca-1,6,8-triene.
| Compound Name | 7-ethyl-4-methyl-5-prop-2-enylidenedeca-1,6,8-triene |
|---|---|
| PubChem CID | 123252708 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 7-ethyl-4-methyl-5-prop-2-enylidenedeca-1,6,8-triene |
| SMILES | C=CC=C(C=C(C=CC)CC)C(C)CC=C |
| InChI | InChI=1S/C16H24/c1-6-10-14(5)16(12-8-3)13-15(9-4)11-7-2/h6-8,11-14H,1,3,9-10H2,2,4-5H3 |
| InChIKey | DGEMKXPHDUIADV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|