C10H15NO4 — CID 155936472
2-[carboxymethyl-[(2E,4E)-hexa-2,4-dienyl]amino]acetic acid (PubChem CID 155936472) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-[carboxymethyl-[(2E,4E)-hexa-2,4-dienyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(2E,4E)-hexa-2,4-dienyl]amino]acetic acid |
|---|---|
| PubChem CID | 155936472 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-[carboxymethyl-[(2E,4E)-hexa-2,4-dienyl]amino]acetic acid |
| SMILES | C/C=C/C=C/CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H15NO4/c1-2-3-4-5-6-11(7-9(12)13)8-10(14)15/h2-5H,6-8H2,1H3,(H,12,13)(H,14,15)/b3-2+,5-4+ |
| InChIKey | LXHJTOKSDMNDQF-MQQKCMAXSA-N |
| XLogP | 0.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|