About (2-hydroxy-1,1-dinitrooxyethyl) nitrate
(2-hydroxy-1,1-dinitrooxyethyl) nitrate (PubChem CID 14949879) has the molecular formula C2H3N3O10
and a molecular weight of 229.06 g/mol. Its IUPAC name is (2-hydroxy-1,1-dinitrooxyethyl) nitrate.
Molecular Properties
| Compound Name | (2-hydroxy-1,1-dinitrooxyethyl) nitrate |
| PubChem CID | 14949879 |
| Molecular Formula | C2H3N3O10 |
| Molecular Weight | 229.06 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | (2-hydroxy-1,1-dinitrooxyethyl) nitrate |
| SMILES | O=[N+]([O-])OC(CO)(O[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C2H3N3O10/c6-1-2(13-3(7)8,14-4(9)10)15-5(11)12/h6H,1H2 |
| InChIKey | AAZVJWGWLPMWQO-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 177.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.06 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-1,1-dinitrooxyethyl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-1,1-dinitrooxyethyl) nitrate?
The IUPAC name of (2-hydroxy-1,1-dinitrooxyethyl) nitrate (CID 14949879) is (2-hydroxy-1,1-dinitrooxyethyl) nitrate.
What is the SMILES notation for (2-hydroxy-1,1-dinitrooxyethyl) nitrate?
The canonical SMILES for (2-hydroxy-1,1-dinitrooxyethyl) nitrate is O=[N+]([O-])OC(CO)(O[N+](=O)[O-])O[N+](=O)[O-].
What is the InChIKey of (2-hydroxy-1,1-dinitrooxyethyl) nitrate?
The InChIKey is AAZVJWGWLPMWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3N3O10/c6-1-2(13-3(7)8,14-4(9)10)15-5(11)12/h6H,1H2.
What are the key properties of (2-hydroxy-1,1-dinitrooxyethyl) nitrate?
(2-hydroxy-1,1-dinitrooxyethyl) nitrate has a molecular weight of 229.06 g/mol, XLogP of -1.74, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-1,1-dinitrooxyethyl) nitrate is sourced from PubChem (CID 14949879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).