C4H4Cl5NO6 — CID 175238730
(1,2,3-trichloro-3-chlorooxy-1,4-dihydroxy-1-nitrobutan-2-yl) hypochlorite (PubChem CID 175238730) has the molecular formula C4H4Cl5NO6 and a molecular weight of 339.34 g/mol. Its IUPAC name is (1,2,3-trichloro-3-chlorooxy-1,4-dihydroxy-1-nitrobutan-2-yl) hypochlorite.
| Compound Name | (1,2,3-trichloro-3-chlorooxy-1,4-dihydroxy-1-nitrobutan-2-yl) hypochlorite |
|---|---|
| PubChem CID | 175238730 |
| Molecular Formula | C4H4Cl5NO6 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 336.85 |
| IUPAC Name | (1,2,3-trichloro-3-chlorooxy-1,4-dihydroxy-1-nitrobutan-2-yl) hypochlorite |
| SMILES | O=[N+]([O-])C(O)(Cl)C(Cl)(OCl)C(Cl)(CO)OCl |
| InChI | InChI=1S/C4H4Cl5NO6/c5-2(1-11,15-8)3(6,16-9)4(7,12)10(13)14/h11-12H,1H2 |
| InChIKey | WFOKXDMJGBVCMV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|