(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate

C4H7N3O12 — CID 137346138

IUPAC(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate
SMILESO=[N+]([O-])OC(O)(CCO)C(O)(O[N+](=O)[O-])O[N+](=O)[O-]
InChIInChI=1S/C4H7N3O12/c8-2-1-3(9,17-5(11)12)4(10,18-6(13)14)19-7(15)16/h8-10H,1-2H2
InChIKeyNKDCZFVDCRYDTF-UHFFFAOYSA-N
MW289.11 g/mol
LogP-2.67
Rot. Bonds9

About (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate

(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate (PubChem CID 137346138) has the molecular formula C4H7N3O12 and a molecular weight of 289.11 g/mol. Its IUPAC name is (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate.

Molecular Properties

Compound Name(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate
PubChem CID137346138
Molecular FormulaC4H7N3O12
Molecular Weight289.11 g/mol
Exact Mass289.00
IUPAC Name(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate
SMILESO=[N+]([O-])OC(O)(CCO)C(O)(O[N+](=O)[O-])O[N+](=O)[O-]
InChIInChI=1S/C4H7N3O12/c8-2-1-3(9,17-5(11)12)4(10,18-6(13)14)19-7(15)16/h8-10H,1-2H2
InChIKeyNKDCZFVDCRYDTF-UHFFFAOYSA-N
XLogP-2.67
TPSA217.80 Ų
H-Bond Donors3
H-Bond Acceptors12
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500289.11
LogP ≤ 5-2.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 1012

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate?
The IUPAC name of (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate (CID 137346138) is (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate.
What is the SMILES notation for (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate?
The canonical SMILES for (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate is O=[N+]([O-])OC(O)(CCO)C(O)(O[N+](=O)[O-])O[N+](=O)[O-].
What is the InChIKey of (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate?
The InChIKey is NKDCZFVDCRYDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O12/c8-2-1-3(9,17-5(11)12)4(10,18-6(13)14)19-7(15)16/h8-10H,1-2H2.
What are the key properties of (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate?
(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate has a molecular weight of 289.11 g/mol, XLogP of -2.67, 9 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate is sourced from PubChem (CID 137346138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).