C4H7N3O12 — CID 137346138
(1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate (PubChem CID 137346138) has the molecular formula C4H7N3O12 and a molecular weight of 289.11 g/mol. Its IUPAC name is (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate.
| Compound Name | (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate |
|---|---|
| PubChem CID | 137346138 |
| Molecular Formula | C4H7N3O12 |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (1,2,4-trihydroxy-1,1-dinitrooxybutan-2-yl) nitrate |
| SMILES | O=[N+]([O-])OC(O)(CCO)C(O)(O[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C4H7N3O12/c8-2-1-3(9,17-5(11)12)4(10,18-6(13)14)19-7(15)16/h8-10H,1-2H2 |
| InChIKey | NKDCZFVDCRYDTF-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 217.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|