C10H16NO5P — CID 174603848
2-(hydroxymethyl)-2-nitropropane-1,3-diol;phenylphosphane (PubChem CID 174603848) has the molecular formula C10H16NO5P and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-nitropropane-1,3-diol;phenylphosphane.
| Compound Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;phenylphosphane |
|---|---|
| PubChem CID | 174603848 |
| Molecular Formula | C10H16NO5P |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(hydroxymethyl)-2-nitropropane-1,3-diol;phenylphosphane |
| SMILES | O=[N+]([O-])C(CO)(CO)CO.Pc1ccccc1 |
| InChI | InChI=1S/C6H7P.C4H9NO5/c7-6-4-2-1-3-5-6;6-1-4(2-7,3-8)5(9)10/h1-5H,7H2;6-8H,1-3H2 |
| InChIKey | QSVPEYIODAWHSL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|