About benzenecarboximidamide;1H-pyrrole
benzenecarboximidamide;1H-pyrrole (PubChem CID 158593667) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is benzenecarboximidamide;1H-pyrrole.
Molecular Properties
| Compound Name | benzenecarboximidamide;1H-pyrrole |
| PubChem CID | 158593667 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | benzenecarboximidamide;1H-pyrrole |
| SMILES | [H]/N=C(\N)c1ccccc1.c1cc[nH]c1 |
| InChI | InChI=1S/C7H8N2.C4H5N/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H3,8,9);1-5H |
| InChIKey | HUTFEHKYRRODOK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;1H-pyrrole?
The IUPAC name of benzenecarboximidamide;1H-pyrrole (CID 158593667) is benzenecarboximidamide;1H-pyrrole.
What is the SMILES notation for benzenecarboximidamide;1H-pyrrole?
The canonical SMILES for benzenecarboximidamide;1H-pyrrole is [H]/N=C(\N)c1ccccc1.c1cc[nH]c1.
What is the InChIKey of benzenecarboximidamide;1H-pyrrole?
The InChIKey is HUTFEHKYRRODOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2.C4H5N/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H3,8,9);1-5H.
What are the key properties of benzenecarboximidamide;1H-pyrrole?
benzenecarboximidamide;1H-pyrrole has a molecular weight of 187.25 g/mol, XLogP of 1.99, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;1H-pyrrole is sourced from PubChem (CID 158593667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).