C16H16N4 — CID 155294731
2-[4-(aminomethyl)phenyl]-1H-indole-6-carboximidamide (PubChem CID 155294731) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]-1H-indole-6-carboximidamide.
| Compound Name | 2-[4-(aminomethyl)phenyl]-1H-indole-6-carboximidamide |
|---|---|
| PubChem CID | 155294731 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]-1H-indole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(-c3ccc(CN)cc3)[nH]c2c1 |
| InChI | InChI=1S/C16H16N4/c17-9-10-1-3-11(4-2-10)14-7-12-5-6-13(16(18)19)8-15(12)20-14/h1-8,20H,9,17H2,(H3,18,19) |
| InChIKey | BJDUKKLKYRGPGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|