C16H17Cl2N5 — CID 172946437
[amino-[4-[6-[amino(azaniumylidene)methyl]-1H-indol-2-yl]phenyl]methylidene]azanium dichloride (PubChem CID 172946437) has the molecular formula C16H17Cl2N5 and a molecular weight of 350.25 g/mol. Its IUPAC name is [amino-[4-[6-[amino(azaniumylidene)methyl]-1H-indol-2-yl]phenyl]methylidene]azanium dichloride.
| Compound Name | [amino-[4-[6-[amino(azaniumylidene)methyl]-1H-indol-2-yl]phenyl]methylidene]azanium dichloride |
|---|---|
| PubChem CID | 172946437 |
| Molecular Formula | C16H17Cl2N5 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [amino-[4-[6-[amino(azaniumylidene)methyl]-1H-indol-2-yl]phenyl]methylidene]azanium dichloride |
| SMILES | NC(=[NH2+])c1ccc(-c2cc3ccc(C(N)=[NH2+])cc3[nH]2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C16H15N5.2ClH/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13;;/h1-8,21H,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | FPNZBYLXNYPRLR-UHFFFAOYSA-N |
| XLogP | -7.23 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -7.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|