C16H19Cl2N5O — CID 18676829
2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;hydrate;dihydrochloride (PubChem CID 18676829) has the molecular formula C16H19Cl2N5O and a molecular weight of 368.27 g/mol. Its IUPAC name is 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;hydrate;dihydrochloride.
| Compound Name | 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 18676829 |
| Molecular Formula | C16H19Cl2N5O |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;hydrate;dihydrochloride |
| SMILES | Cl.Cl.O.[H]/N=C(\N)c1ccc(-c2cc3ccc(/C(N)=N/[H])cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H15N5.2ClH.H2O/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13;;;/h1-8,21H,(H3,17,18)(H3,19,20);2*1H;1H2 |
| InChIKey | UJLVGXGUAMGVEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|