C23H20N4 — CID 165097178
2-[4-(4-ethanimidoylphenyl)phenyl]-1H-indole-5-carboximidamide (PubChem CID 165097178) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[4-(4-ethanimidoylphenyl)phenyl]-1H-indole-5-carboximidamide.
| Compound Name | 2-[4-(4-ethanimidoylphenyl)phenyl]-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 165097178 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[4-(4-ethanimidoylphenyl)phenyl]-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(-c3ccc(-c4ccc(/C(C)=N/[H])cc4)cc3)cc2c1 |
| InChI | InChI=1S/C23H20N4/c1-14(24)15-2-4-16(5-3-15)17-6-8-18(9-7-17)22-13-20-12-19(23(25)26)10-11-21(20)27-22/h2-13,24,27H,1H3,(H3,25,26)/b24-14+ |
| InChIKey | IGRRWSCZHNDFAM-ZVHZXABRSA-N |
| XLogP | 5.17 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|