C21H23ClN4 — CID 25254513
2-[3-chloro-5-(piperidin-1-ylmethyl)phenyl]-1H-indole-5-carboximidamide (PubChem CID 25254513) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is 2-[3-chloro-5-(piperidin-1-ylmethyl)phenyl]-1H-indole-5-carboximidamide.
| Compound Name | 2-[3-chloro-5-(piperidin-1-ylmethyl)phenyl]-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 25254513 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[3-chloro-5-(piperidin-1-ylmethyl)phenyl]-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(-c3cc(Cl)cc(CN4CCCCC4)c3)cc2c1 |
| InChI | InChI=1S/C21H23ClN4/c22-18-9-14(13-26-6-2-1-3-7-26)8-16(11-18)20-12-17-10-15(21(23)24)4-5-19(17)25-20/h4-5,8-12,25H,1-3,6-7,13H2,(H3,23,24) |
| InChIKey | PZKCMIIOBXFUKI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|